C20H41NO4Si — CID 175157505
tert-butyl-[(1R,3R,4S)-3-(hydroxymethyl)-4-tri(propan-2-yl)silyloxycyclopentyl]carbamic acid (PubChem CID 175157505) has the molecular formula C20H41NO4Si and a molecular weight of 387.64 g/mol. Its IUPAC name is tert-butyl-[(1R,3R,4S)-3-(hydroxymethyl)-4-tri(propan-2-yl)silyloxycyclopentyl]carbamic acid.
| Compound Name | tert-butyl-[(1R,3R,4S)-3-(hydroxymethyl)-4-tri(propan-2-yl)silyloxycyclopentyl]carbamic acid |
|---|---|
| PubChem CID | 175157505 |
| Molecular Formula | C20H41NO4Si |
| Molecular Weight | 387.64 g/mol |
| Exact Mass | 387.28 |
| IUPAC Name | tert-butyl-[(1R,3R,4S)-3-(hydroxymethyl)-4-tri(propan-2-yl)silyloxycyclopentyl]carbamic acid |
| SMILES | CC(C)[Si](O[C@H]1C[C@H](N(C(=O)O)C(C)(C)C)C[C@@H]1CO)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H41NO4Si/c1-13(2)26(14(3)4,15(5)6)25-18-11-17(10-16(18)12-22)21(19(23)24)20(7,8)9/h13-18,22H,10-12H2,1-9H3,(H,23,24)/t16-,17-,18+/m1/s1 |
| InChIKey | IESWFGMIOIAUPH-KURKYZTESA-N |
| XLogP | 5.10 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.64 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|