C10H9F9O — CID 175157793
2-(4,4,5,5,6,6,8,8,8-nonafluorooct-2-enyl)oxirane (PubChem CID 175157793) has the molecular formula C10H9F9O and a molecular weight of 316.16 g/mol. Its IUPAC name is 2-(4,4,5,5,6,6,8,8,8-nonafluorooct-2-enyl)oxirane.
| Compound Name | 2-(4,4,5,5,6,6,8,8,8-nonafluorooct-2-enyl)oxirane |
|---|---|
| PubChem CID | 175157793 |
| Molecular Formula | C10H9F9O |
| Molecular Weight | 316.16 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 2-(4,4,5,5,6,6,8,8,8-nonafluorooct-2-enyl)oxirane |
| SMILES | FC(F)(F)CC(F)(F)C(F)(F)C(F)(F)C=CCC1CO1 |
| InChI | InChI=1S/C10H9F9O/c11-7(12,3-1-2-6-4-20-6)10(18,19)8(13,14)5-9(15,16)17/h1,3,6H,2,4-5H2 |
| InChIKey | MHUBTTWINQIHIZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.16 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|