C12H7Cl2N3O3S — CID 175157801
3-(2,5-dichloropyrimidin-4-yl)indole-1-sulfonic acid (PubChem CID 175157801) has the molecular formula C12H7Cl2N3O3S and a molecular weight of 344.18 g/mol. Its IUPAC name is 3-(2,5-dichloropyrimidin-4-yl)indole-1-sulfonic acid.
| Compound Name | 3-(2,5-dichloropyrimidin-4-yl)indole-1-sulfonic acid |
|---|---|
| PubChem CID | 175157801 |
| Molecular Formula | C12H7Cl2N3O3S |
| Molecular Weight | 344.18 g/mol |
| Exact Mass | 342.96 |
| IUPAC Name | 3-(2,5-dichloropyrimidin-4-yl)indole-1-sulfonic acid |
| SMILES | O=S(=O)(O)n1cc(-c2nc(Cl)ncc2Cl)c2ccccc21 |
| InChI | InChI=1S/C12H7Cl2N3O3S/c13-9-5-15-12(14)16-11(9)8-6-17(21(18,19)20)10-4-2-1-3-7(8)10/h1-6H,(H,18,19,20) |
| InChIKey | NAVSLARRBOKPDX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.18 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|