C17H13N3O2 — CID 175157829
methyl 4-methyl-3-[2-(5H-pyrrolo[2,3-b]pyrazin-3-yl)ethynyl]benzoate (PubChem CID 175157829) has the molecular formula C17H13N3O2 and a molecular weight of 291.31 g/mol. Its IUPAC name is methyl 4-methyl-3-[2-(5H-pyrrolo[2,3-b]pyrazin-3-yl)ethynyl]benzoate.
| Compound Name | methyl 4-methyl-3-[2-(5H-pyrrolo[2,3-b]pyrazin-3-yl)ethynyl]benzoate |
|---|---|
| PubChem CID | 175157829 |
| Molecular Formula | C17H13N3O2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | methyl 4-methyl-3-[2-(5H-pyrrolo[2,3-b]pyrazin-3-yl)ethynyl]benzoate |
| SMILES | COC(=O)c1ccc(C)c(C#Cc2cnc3cc[nH]c3n2)c1 |
| InChI | InChI=1S/C17H13N3O2/c1-11-3-4-13(17(21)22-2)9-12(11)5-6-14-10-19-15-7-8-18-16(15)20-14/h3-4,7-10H,1-2H3,(H,18,20) |
| InChIKey | TWWGGSHOPCBUJF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|