C26H23NO2S — CID 175158278
N,3-dimethyl-2,4,5-triphenylbenzenesulfonamide (PubChem CID 175158278) has the molecular formula C26H23NO2S and a molecular weight of 413.54 g/mol. Its IUPAC name is N,3-dimethyl-2,4,5-triphenylbenzenesulfonamide.
| Compound Name | N,3-dimethyl-2,4,5-triphenylbenzenesulfonamide |
|---|---|
| PubChem CID | 175158278 |
| Molecular Formula | C26H23NO2S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | N,3-dimethyl-2,4,5-triphenylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cc(-c2ccccc2)c(-c2ccccc2)c(C)c1-c1ccccc1 |
| InChI | InChI=1S/C26H23NO2S/c1-19-25(21-14-8-4-9-15-21)23(20-12-6-3-7-13-20)18-24(30(28,29)27-2)26(19)22-16-10-5-11-17-22/h3-18,27H,1-2H3 |
| InChIKey | MODDMFKNAYXCCW-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |