About 3-phenylporphyrin-2,20-diamine
3-phenylporphyrin-2,20-diamine (PubChem CID 175158434) has the molecular formula C26H18N6
and a molecular weight of 414.47 g/mol. Its IUPAC name is 3-phenylporphyrin-2,20-diamine.
Molecular Properties
| Compound Name | 3-phenylporphyrin-2,20-diamine |
| PubChem CID | 175158434 |
| Molecular Formula | C26H18N6 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 3-phenylporphyrin-2,20-diamine |
| SMILES | NC1=C(c2ccccc2)C2=N/C1=C(/N)C1=N/C(=C\C3=N/C(=C\C4=N/C(=C\2)C=C4)C=C3)C=C1 |
| InChI | InChI=1S/C26H18N6/c27-24-21-11-10-19(31-21)13-18-7-6-16(29-18)12-17-8-9-20(30-17)14-22-23(25(28)26(24)32-22)15-4-2-1-3-5-15/h1-14H,27-28H2/b16-12-,17-12-,18-13-,19-13-,20-14-,22-14-,24-21+,26-24+ |
| InChIKey | KYYCUWWMGBZOGG-AODYIJJSSA-N |
| XLogP | 3.68 |
| TPSA | 101.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-phenylporphyrin-2,20-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylporphyrin-2,20-diamine?
The IUPAC name of 3-phenylporphyrin-2,20-diamine (CID 175158434) is 3-phenylporphyrin-2,20-diamine.
What is the SMILES notation for 3-phenylporphyrin-2,20-diamine?
The canonical SMILES for 3-phenylporphyrin-2,20-diamine is NC1=C(c2ccccc2)C2=N/C1=C(/N)C1=N/C(=C\C3=N/C(=C\C4=N/C(=C\2)C=C4)C=C3)C=C1.
What is the InChIKey of 3-phenylporphyrin-2,20-diamine?
The InChIKey is KYYCUWWMGBZOGG-AODYIJJSSA-N. The full InChI is InChI=1S/C26H18N6/c27-24-21-11-10-19(31-21)13-18-7-6-16(29-18)12-17-8-9-20(30-17)14-22-23(25(28)26(24)32-22)15-4-2-1-3-5-15/h1-14H,27-28H2/b16-12-,17-12-,18-13-,19-13-,20-14-,22-14-,24-21+,26-24+.
What are the key properties of 3-phenylporphyrin-2,20-diamine?
3-phenylporphyrin-2,20-diamine has a molecular weight of 414.47 g/mol, XLogP of 3.68, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylporphyrin-2,20-diamine is sourced from PubChem (CID 175158434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).