About 2-aminopropyl pyrrolidine-1-carboxylate
2-aminopropyl pyrrolidine-1-carboxylate (PubChem CID 175158579) has the molecular formula C8H16N2O2
and a molecular weight of 172.23 g/mol. Its IUPAC name is 2-aminopropyl pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | 2-aminopropyl pyrrolidine-1-carboxylate |
| PubChem CID | 175158579 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | 2-aminopropyl pyrrolidine-1-carboxylate |
| SMILES | CC(N)COC(=O)N1CCCC1 |
| InChI | InChI=1S/C8H16N2O2/c1-7(9)6-12-8(11)10-4-2-3-5-10/h7H,2-6,9H2,1H3 |
| InChIKey | DYOFGXHTUTWBLQ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-aminopropyl pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminopropyl pyrrolidine-1-carboxylate?
The IUPAC name of 2-aminopropyl pyrrolidine-1-carboxylate (CID 175158579) is 2-aminopropyl pyrrolidine-1-carboxylate.
What is the SMILES notation for 2-aminopropyl pyrrolidine-1-carboxylate?
The canonical SMILES for 2-aminopropyl pyrrolidine-1-carboxylate is CC(N)COC(=O)N1CCCC1.
What is the InChIKey of 2-aminopropyl pyrrolidine-1-carboxylate?
The InChIKey is DYOFGXHTUTWBLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O2/c1-7(9)6-12-8(11)10-4-2-3-5-10/h7H,2-6,9H2,1H3.
What are the key properties of 2-aminopropyl pyrrolidine-1-carboxylate?
2-aminopropyl pyrrolidine-1-carboxylate has a molecular weight of 172.23 g/mol, XLogP of 0.57, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminopropyl pyrrolidine-1-carboxylate is sourced from PubChem (CID 175158579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).