About 1,1-difluorocyclobutane;methylurea;hydrochloride
1,1-difluorocyclobutane;methylurea;hydrochloride (PubChem CID 175158753) has the molecular formula C6H13ClF2N2O
and a molecular weight of 202.63 g/mol. Its IUPAC name is 1,1-difluorocyclobutane;methylurea;hydrochloride.
Molecular Properties
| Compound Name | 1,1-difluorocyclobutane;methylurea;hydrochloride |
| PubChem CID | 175158753 |
| Molecular Formula | C6H13ClF2N2O |
| Molecular Weight | 202.63 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 1,1-difluorocyclobutane;methylurea;hydrochloride |
| SMILES | CNC(N)=O.Cl.FC1(F)CCC1 |
| InChI | InChI=1S/C4H6F2.C2H6N2O.ClH/c5-4(6)2-1-3-4;1-4-2(3)5;/h1-3H2;1H3,(H3,3,4,5);1H |
| InChIKey | PIPAYXZNBJHZHO-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.63 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,1-difluorocyclobutane;methylurea;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluorocyclobutane;methylurea;hydrochloride?
The IUPAC name of 1,1-difluorocyclobutane;methylurea;hydrochloride (CID 175158753) is 1,1-difluorocyclobutane;methylurea;hydrochloride.
What is the SMILES notation for 1,1-difluorocyclobutane;methylurea;hydrochloride?
The canonical SMILES for 1,1-difluorocyclobutane;methylurea;hydrochloride is CNC(N)=O.Cl.FC1(F)CCC1.
What is the InChIKey of 1,1-difluorocyclobutane;methylurea;hydrochloride?
The InChIKey is PIPAYXZNBJHZHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6F2.C2H6N2O.ClH/c5-4(6)2-1-3-4;1-4-2(3)5;/h1-3H2;1H3,(H3,3,4,5);1H.
What are the key properties of 1,1-difluorocyclobutane;methylurea;hydrochloride?
1,1-difluorocyclobutane;methylurea;hydrochloride has a molecular weight of 202.63 g/mol, XLogP of 1.51, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluorocyclobutane;methylurea;hydrochloride is sourced from PubChem (CID 175158753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).