About 1-butyl-2H-quinoline;hexafluoroantimony(1-)
1-butyl-2H-quinoline;hexafluoroantimony(1-) (PubChem CID 175158891) has the molecular formula C13H17F6NSb-
and a molecular weight of 423.03 g/mol. Its IUPAC name is 1-butyl-2H-quinoline;hexafluoroantimony(1-).
Molecular Properties
| Compound Name | 1-butyl-2H-quinoline;hexafluoroantimony(1-) |
| PubChem CID | 175158891 |
| Molecular Formula | C13H17F6NSb- |
| Molecular Weight | 423.03 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | 1-butyl-2H-quinoline;hexafluoroantimony(1-) |
| SMILES | CCCCN1CC=Cc2ccccc21.F[Sb-](F)(F)(F)(F)F |
| InChI | InChI=1S/C13H17N.6FH.Sb/c1-2-3-10-14-11-6-8-12-7-4-5-9-13(12)14;;;;;;;/h4-9H,2-3,10-11H2,1H3;6*1H;/q;;;;;;;+5/p-6 |
| InChIKey | AEDBKIFEQDRJFD-UHFFFAOYSA-H |
| XLogP | 5.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.03 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-2H-quinoline;hexafluoroantimony(1-) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-2H-quinoline;hexafluoroantimony(1-)?
The IUPAC name of 1-butyl-2H-quinoline;hexafluoroantimony(1-) (CID 175158891) is 1-butyl-2H-quinoline;hexafluoroantimony(1-).
What is the SMILES notation for 1-butyl-2H-quinoline;hexafluoroantimony(1-)?
The canonical SMILES for 1-butyl-2H-quinoline;hexafluoroantimony(1-) is CCCCN1CC=Cc2ccccc21.F[Sb-](F)(F)(F)(F)F.
What is the InChIKey of 1-butyl-2H-quinoline;hexafluoroantimony(1-)?
The InChIKey is AEDBKIFEQDRJFD-UHFFFAOYSA-H. The full InChI is InChI=1S/C13H17N.6FH.Sb/c1-2-3-10-14-11-6-8-12-7-4-5-9-13(12)14;;;;;;;/h4-9H,2-3,10-11H2,1H3;6*1H;/q;;;;;;;+5/p-6.
What are the key properties of 1-butyl-2H-quinoline;hexafluoroantimony(1-)?
1-butyl-2H-quinoline;hexafluoroantimony(1-) has a molecular weight of 423.03 g/mol, XLogP of 5.46, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-2H-quinoline;hexafluoroantimony(1-) is sourced from PubChem (CID 175158891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).