About ethenyl(dimethyl)silane;styrene
ethenyl(dimethyl)silane;styrene (PubChem CID 175158934) has the molecular formula C12H18Si
and a molecular weight of 190.36 g/mol. Its IUPAC name is ethenyl(dimethyl)silane;styrene.
Molecular Properties
| Compound Name | ethenyl(dimethyl)silane;styrene |
| PubChem CID | 175158934 |
| Molecular Formula | C12H18Si |
| Molecular Weight | 190.36 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | ethenyl(dimethyl)silane;styrene |
| SMILES | C=C[SiH](C)C.C=Cc1ccccc1 |
| InChI | InChI=1S/C8H8.C4H10Si/c1-2-8-6-4-3-5-7-8;1-4-5(2)3/h2-7H,1H2;4-5H,1H2,2-3H3 |
| InChIKey | MDGCPZHDSSGGMU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethenyl(dimethyl)silane;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl(dimethyl)silane;styrene?
The IUPAC name of ethenyl(dimethyl)silane;styrene (CID 175158934) is ethenyl(dimethyl)silane;styrene.
What is the SMILES notation for ethenyl(dimethyl)silane;styrene?
The canonical SMILES for ethenyl(dimethyl)silane;styrene is C=C[SiH](C)C.C=Cc1ccccc1.
What is the InChIKey of ethenyl(dimethyl)silane;styrene?
The InChIKey is MDGCPZHDSSGGMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8.C4H10Si/c1-2-8-6-4-3-5-7-8;1-4-5(2)3/h2-7H,1H2;4-5H,1H2,2-3H3.
What are the key properties of ethenyl(dimethyl)silane;styrene?
ethenyl(dimethyl)silane;styrene has a molecular weight of 190.36 g/mol, XLogP of 3.53, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl(dimethyl)silane;styrene is sourced from PubChem (CID 175158934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).