About 4,6-dimethoxy-5-oxocyclohexa-1,3-diene-1-carbaldehyde
4,6-dimethoxy-5-oxocyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 175159439) has the molecular formula C9H10O4
and a molecular weight of 182.17 g/mol. Its IUPAC name is 4,6-dimethoxy-5-oxocyclohexa-1,3-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 4,6-dimethoxy-5-oxocyclohexa-1,3-diene-1-carbaldehyde |
| PubChem CID | 175159439 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 4,6-dimethoxy-5-oxocyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | COC1=CC=C(C=O)C(OC)C1=O |
| InChI | InChI=1S/C9H10O4/c1-12-7-4-3-6(5-10)9(13-2)8(7)11/h3-5,9H,1-2H3 |
| InChIKey | BXFXJBNPUGFPNN-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4,6-dimethoxy-5-oxocyclohexa-1,3-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethoxy-5-oxocyclohexa-1,3-diene-1-carbaldehyde?
The IUPAC name of 4,6-dimethoxy-5-oxocyclohexa-1,3-diene-1-carbaldehyde (CID 175159439) is 4,6-dimethoxy-5-oxocyclohexa-1,3-diene-1-carbaldehyde.
What is the SMILES notation for 4,6-dimethoxy-5-oxocyclohexa-1,3-diene-1-carbaldehyde?
The canonical SMILES for 4,6-dimethoxy-5-oxocyclohexa-1,3-diene-1-carbaldehyde is COC1=CC=C(C=O)C(OC)C1=O.
What is the InChIKey of 4,6-dimethoxy-5-oxocyclohexa-1,3-diene-1-carbaldehyde?
The InChIKey is BXFXJBNPUGFPNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O4/c1-12-7-4-3-6(5-10)9(13-2)8(7)11/h3-5,9H,1-2H3.
What are the key properties of 4,6-dimethoxy-5-oxocyclohexa-1,3-diene-1-carbaldehyde?
4,6-dimethoxy-5-oxocyclohexa-1,3-diene-1-carbaldehyde has a molecular weight of 182.17 g/mol, XLogP of 0.24, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethoxy-5-oxocyclohexa-1,3-diene-1-carbaldehyde is sourced from PubChem (CID 175159439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).