About [2-(trifluoromethyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-4-yl] carbamate
[2-(trifluoromethyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-4-yl] carbamate (PubChem CID 175160197) has the molecular formula C10H9F3N2O2
and a molecular weight of 246.19 g/mol. Its IUPAC name is [2-(trifluoromethyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-4-yl] carbamate.
Molecular Properties
| Compound Name | [2-(trifluoromethyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-4-yl] carbamate |
| PubChem CID | 175160197 |
| Molecular Formula | C10H9F3N2O2 |
| Molecular Weight | 246.19 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | [2-(trifluoromethyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-4-yl] carbamate |
| SMILES | NC(=O)Oc1cc(C(F)(F)F)nc2c1CCC2 |
| InChI | InChI=1S/C10H9F3N2O2/c11-10(12,13)8-4-7(17-9(14)16)5-2-1-3-6(5)15-8/h4H,1-3H2,(H2,14,16) |
| InChIKey | CHICIYVZCUARCC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.19 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(trifluoromethyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-4-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(trifluoromethyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-4-yl] carbamate?
The IUPAC name of [2-(trifluoromethyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-4-yl] carbamate (CID 175160197) is [2-(trifluoromethyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-4-yl] carbamate.
What is the SMILES notation for [2-(trifluoromethyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-4-yl] carbamate?
The canonical SMILES for [2-(trifluoromethyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-4-yl] carbamate is NC(=O)Oc1cc(C(F)(F)F)nc2c1CCC2.
What is the InChIKey of [2-(trifluoromethyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-4-yl] carbamate?
The InChIKey is CHICIYVZCUARCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F3N2O2/c11-10(12,13)8-4-7(17-9(14)16)5-2-1-3-6(5)15-8/h4H,1-3H2,(H2,14,16).
What are the key properties of [2-(trifluoromethyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-4-yl] carbamate?
[2-(trifluoromethyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-4-yl] carbamate has a molecular weight of 246.19 g/mol, XLogP of 2.05, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(trifluoromethyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-4-yl] carbamate is sourced from PubChem (CID 175160197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).