About sodium;hydride;1H-indazole-4-thiol
sodium;hydride;1H-indazole-4-thiol (PubChem CID 175160320) has the molecular formula C7H7N2NaS
and a molecular weight of 174.20 g/mol. Its IUPAC name is sodium;hydride;1H-indazole-4-thiol.
Molecular Properties
| Compound Name | sodium;hydride;1H-indazole-4-thiol |
| PubChem CID | 175160320 |
| Molecular Formula | C7H7N2NaS |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.02 |
| IUPAC Name | sodium;hydride;1H-indazole-4-thiol |
| SMILES | Sc1cccc2[nH]ncc12.[H-].[Na+] |
| InChI | InChI=1S/C7H6N2S.Na.H/c10-7-3-1-2-6-5(7)4-8-9-6;;/h1-4,10H,(H,8,9);;/q;+1;-1 |
| InChIKey | VZPBNOKXARFENY-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;1H-indazole-4-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;1H-indazole-4-thiol?
The IUPAC name of sodium;hydride;1H-indazole-4-thiol (CID 175160320) is sodium;hydride;1H-indazole-4-thiol.
What is the SMILES notation for sodium;hydride;1H-indazole-4-thiol?
The canonical SMILES for sodium;hydride;1H-indazole-4-thiol is Sc1cccc2[nH]ncc12.[H-].[Na+].
What is the InChIKey of sodium;hydride;1H-indazole-4-thiol?
The InChIKey is VZPBNOKXARFENY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2S.Na.H/c10-7-3-1-2-6-5(7)4-8-9-6;;/h1-4,10H,(H,8,9);;/q;+1;-1.
What are the key properties of sodium;hydride;1H-indazole-4-thiol?
sodium;hydride;1H-indazole-4-thiol has a molecular weight of 174.20 g/mol, XLogP of -1.03, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;1H-indazole-4-thiol is sourced from PubChem (CID 175160320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).