C9H20N2O11S2 — CID 175160990
2-[4-(aminomethyl)phenyl]ethane-1,1,2-triol;azane;sulfuric acid (PubChem CID 175160990) has the molecular formula C9H20N2O11S2 and a molecular weight of 396.40 g/mol. Its IUPAC name is 2-[4-(aminomethyl)phenyl]ethane-1,1,2-triol;azane;sulfuric acid.
| Compound Name | 2-[4-(aminomethyl)phenyl]ethane-1,1,2-triol;azane;sulfuric acid |
|---|---|
| PubChem CID | 175160990 |
| Molecular Formula | C9H20N2O11S2 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | 2-[4-(aminomethyl)phenyl]ethane-1,1,2-triol;azane;sulfuric acid |
| SMILES | N.NCc1ccc(C(O)C(O)O)cc1.O=S(=O)(O)O.O=S(=O)(O)O |
| InChI | InChI=1S/C9H13NO3.H3N.2H2O4S/c10-5-6-1-3-7(4-2-6)8(11)9(12)13;;2*1-5(2,3)4/h1-4,8-9,11-13H,5,10H2;1H3;2*(H2,1,2,3,4) |
| InChIKey | QRBBKGNHPYKMOB-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 270.91 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|