About 1-methylimidazolidin-2-one;propan-2-one
1-methylimidazolidin-2-one;propan-2-one (PubChem CID 175161965) has the molecular formula C7H14N2O2
and a molecular weight of 158.20 g/mol. Its IUPAC name is 1-methylimidazolidin-2-one;propan-2-one.
Molecular Properties
| Compound Name | 1-methylimidazolidin-2-one;propan-2-one |
| PubChem CID | 175161965 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 1-methylimidazolidin-2-one;propan-2-one |
| SMILES | CC(C)=O.CN1CCNC1=O |
| InChI | InChI=1S/C4H8N2O.C3H6O/c1-6-3-2-5-4(6)7;1-3(2)4/h2-3H2,1H3,(H,5,7);1-2H3 |
| InChIKey | ACOMLNLBDMBVTQ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methylimidazolidin-2-one;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylimidazolidin-2-one;propan-2-one?
The IUPAC name of 1-methylimidazolidin-2-one;propan-2-one (CID 175161965) is 1-methylimidazolidin-2-one;propan-2-one.
What is the SMILES notation for 1-methylimidazolidin-2-one;propan-2-one?
The canonical SMILES for 1-methylimidazolidin-2-one;propan-2-one is CC(C)=O.CN1CCNC1=O.
What is the InChIKey of 1-methylimidazolidin-2-one;propan-2-one?
The InChIKey is ACOMLNLBDMBVTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O.C3H6O/c1-6-3-2-5-4(6)7;1-3(2)4/h2-3H2,1H3,(H,5,7);1-2H3.
What are the key properties of 1-methylimidazolidin-2-one;propan-2-one?
1-methylimidazolidin-2-one;propan-2-one has a molecular weight of 158.20 g/mol, XLogP of 0.24, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylimidazolidin-2-one;propan-2-one is sourced from PubChem (CID 175161965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).