About 1-benzylpyridin-1-ium;copper
1-benzylpyridin-1-ium;copper (PubChem CID 175162288) has the molecular formula C12H12CuN+
and a molecular weight of 233.78 g/mol. Its IUPAC name is 1-benzylpyridin-1-ium;copper.
Molecular Properties
| Compound Name | 1-benzylpyridin-1-ium;copper |
| PubChem CID | 175162288 |
| Molecular Formula | C12H12CuN+ |
| Molecular Weight | 233.78 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | 1-benzylpyridin-1-ium;copper |
| SMILES | [Cu].c1ccc(C[n+]2ccccc2)cc1 |
| InChI | InChI=1S/C12H12N.Cu/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;/h1-10H,11H2;/q+1; |
| InChIKey | XRLCAPWIPIERPX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.78 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-benzylpyridin-1-ium;copper with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzylpyridin-1-ium;copper?
The IUPAC name of 1-benzylpyridin-1-ium;copper (CID 175162288) is 1-benzylpyridin-1-ium;copper.
What is the SMILES notation for 1-benzylpyridin-1-ium;copper?
The canonical SMILES for 1-benzylpyridin-1-ium;copper is [Cu].c1ccc(C[n+]2ccccc2)cc1.
What is the InChIKey of 1-benzylpyridin-1-ium;copper?
The InChIKey is XRLCAPWIPIERPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N.Cu/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;/h1-10H,11H2;/q+1;.
What are the key properties of 1-benzylpyridin-1-ium;copper?
1-benzylpyridin-1-ium;copper has a molecular weight of 233.78 g/mol, XLogP of 2.02, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzylpyridin-1-ium;copper is sourced from PubChem (CID 175162288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).