About silyloxyaluminum(2+) dinitrate
silyloxyaluminum(2+) dinitrate (PubChem CID 175162529) has the molecular formula H3AlN2O7Si
and a molecular weight of 198.10 g/mol. Its IUPAC name is silyloxyaluminum(2+) dinitrate.
Molecular Properties
| Compound Name | silyloxyaluminum(2+) dinitrate |
| PubChem CID | 175162529 |
| Molecular Formula | H3AlN2O7Si |
| Molecular Weight | 198.10 g/mol |
| Exact Mass | 197.95 |
| IUPAC Name | silyloxyaluminum(2+) dinitrate |
| SMILES | O=[N+]([O-])[O-].O=[N+]([O-])[O-].[Al+2]O[SiH3] |
| InChI | InChI=1S/Al.2NO3.H3OSi/c;2*2-1(3)4;1-2/h;;;2H3/q+3;3*-1 |
| InChIKey | DYCKNDHVFLEMET-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 141.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.10 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze silyloxyaluminum(2+) dinitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silyloxyaluminum(2+) dinitrate?
The IUPAC name of silyloxyaluminum(2+) dinitrate (CID 175162529) is silyloxyaluminum(2+) dinitrate.
What is the SMILES notation for silyloxyaluminum(2+) dinitrate?
The canonical SMILES for silyloxyaluminum(2+) dinitrate is O=[N+]([O-])[O-].O=[N+]([O-])[O-].[Al+2]O[SiH3].
What is the InChIKey of silyloxyaluminum(2+) dinitrate?
The InChIKey is DYCKNDHVFLEMET-UHFFFAOYSA-N. The full InChI is InChI=1S/Al.2NO3.H3OSi/c;2*2-1(3)4;1-2/h;;;2H3/q+3;3*-1.
What are the key properties of silyloxyaluminum(2+) dinitrate?
silyloxyaluminum(2+) dinitrate has a molecular weight of 198.10 g/mol, XLogP of -2.11, 0 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for silyloxyaluminum(2+) dinitrate is sourced from PubChem (CID 175162529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).