About 2-cyanoacetamide;N,N-dimethylformamide
2-cyanoacetamide;N,N-dimethylformamide (PubChem CID 175162617) has the molecular formula C6H11N3O2
and a molecular weight of 157.17 g/mol. Its IUPAC name is 2-cyanoacetamide;N,N-dimethylformamide.
Molecular Properties
| Compound Name | 2-cyanoacetamide;N,N-dimethylformamide |
| PubChem CID | 175162617 |
| Molecular Formula | C6H11N3O2 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 2-cyanoacetamide;N,N-dimethylformamide |
| SMILES | CN(C)C=O.N#CCC(N)=O |
| InChI | InChI=1S/C3H4N2O.C3H7NO/c4-2-1-3(5)6;1-4(2)3-5/h1H2,(H2,5,6);3H,1-2H3 |
| InChIKey | WOTNYHUZYCZKAH-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanoacetamide;N,N-dimethylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanoacetamide;N,N-dimethylformamide?
The IUPAC name of 2-cyanoacetamide;N,N-dimethylformamide (CID 175162617) is 2-cyanoacetamide;N,N-dimethylformamide.
What is the SMILES notation for 2-cyanoacetamide;N,N-dimethylformamide?
The canonical SMILES for 2-cyanoacetamide;N,N-dimethylformamide is CN(C)C=O.N#CCC(N)=O.
What is the InChIKey of 2-cyanoacetamide;N,N-dimethylformamide?
The InChIKey is WOTNYHUZYCZKAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2O.C3H7NO/c4-2-1-3(5)6;1-4(2)3-5/h1H2,(H2,5,6);3H,1-2H3.
What are the key properties of 2-cyanoacetamide;N,N-dimethylformamide?
2-cyanoacetamide;N,N-dimethylformamide has a molecular weight of 157.17 g/mol, XLogP of -0.91, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanoacetamide;N,N-dimethylformamide is sourced from PubChem (CID 175162617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).