About N-(2-hydroxyethyl)prop-2-enamide;2-propylhex-2-enamide
N-(2-hydroxyethyl)prop-2-enamide;2-propylhex-2-enamide (PubChem CID 175163441) has the molecular formula C14H26N2O3
and a molecular weight of 270.37 g/mol. Its IUPAC name is N-(2-hydroxyethyl)prop-2-enamide;2-propylhex-2-enamide.
Molecular Properties
| Compound Name | N-(2-hydroxyethyl)prop-2-enamide;2-propylhex-2-enamide |
| PubChem CID | 175163441 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | N-(2-hydroxyethyl)prop-2-enamide;2-propylhex-2-enamide |
| SMILES | C=CC(=O)NCCO.CCCC=C(CCC)C(N)=O |
| InChI | InChI=1S/C9H17NO.C5H9NO2/c1-3-5-7-8(6-4-2)9(10)11;1-2-5(8)6-3-4-7/h7H,3-6H2,1-2H3,(H2,10,11);2,7H,1,3-4H2,(H,6,8) |
| InChIKey | KPDIWPSWPREIEB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(2-hydroxyethyl)prop-2-enamide;2-propylhex-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxyethyl)prop-2-enamide;2-propylhex-2-enamide?
The IUPAC name of N-(2-hydroxyethyl)prop-2-enamide;2-propylhex-2-enamide (CID 175163441) is N-(2-hydroxyethyl)prop-2-enamide;2-propylhex-2-enamide.
What is the SMILES notation for N-(2-hydroxyethyl)prop-2-enamide;2-propylhex-2-enamide?
The canonical SMILES for N-(2-hydroxyethyl)prop-2-enamide;2-propylhex-2-enamide is C=CC(=O)NCCO.CCCC=C(CCC)C(N)=O.
What is the InChIKey of N-(2-hydroxyethyl)prop-2-enamide;2-propylhex-2-enamide?
The InChIKey is KPDIWPSWPREIEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO.C5H9NO2/c1-3-5-7-8(6-4-2)9(10)11;1-2-5(8)6-3-4-7/h7H,3-6H2,1-2H3,(H2,10,11);2,7H,1,3-4H2,(H,6,8).
What are the key properties of N-(2-hydroxyethyl)prop-2-enamide;2-propylhex-2-enamide?
N-(2-hydroxyethyl)prop-2-enamide;2-propylhex-2-enamide has a molecular weight of 270.37 g/mol, XLogP of 1.28, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxyethyl)prop-2-enamide;2-propylhex-2-enamide is sourced from PubChem (CID 175163441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).