About 2-butyl-1H-imidazole;hexanoic acid
2-butyl-1H-imidazole;hexanoic acid (PubChem CID 175164203) has the molecular formula C13H24N2O2
and a molecular weight of 240.35 g/mol. Its IUPAC name is 2-butyl-1H-imidazole;hexanoic acid.
Molecular Properties
| Compound Name | 2-butyl-1H-imidazole;hexanoic acid |
| PubChem CID | 175164203 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | 2-butyl-1H-imidazole;hexanoic acid |
| SMILES | CCCCCC(=O)O.CCCCc1ncc[nH]1 |
| InChI | InChI=1S/C7H12N2.C6H12O2/c1-2-3-4-7-8-5-6-9-7;1-2-3-4-5-6(7)8/h5-6H,2-4H2,1H3,(H,8,9);2-5H2,1H3,(H,7,8) |
| InChIKey | HDWCULVQQOFCSQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butyl-1H-imidazole;hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-1H-imidazole;hexanoic acid?
The IUPAC name of 2-butyl-1H-imidazole;hexanoic acid (CID 175164203) is 2-butyl-1H-imidazole;hexanoic acid.
What is the SMILES notation for 2-butyl-1H-imidazole;hexanoic acid?
The canonical SMILES for 2-butyl-1H-imidazole;hexanoic acid is CCCCCC(=O)O.CCCCc1ncc[nH]1.
What is the InChIKey of 2-butyl-1H-imidazole;hexanoic acid?
The InChIKey is HDWCULVQQOFCSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2.C6H12O2/c1-2-3-4-7-8-5-6-9-7;1-2-3-4-5-6(7)8/h5-6H,2-4H2,1H3,(H,8,9);2-5H2,1H3,(H,7,8).
What are the key properties of 2-butyl-1H-imidazole;hexanoic acid?
2-butyl-1H-imidazole;hexanoic acid has a molecular weight of 240.35 g/mol, XLogP of 3.40, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-1H-imidazole;hexanoic acid is sourced from PubChem (CID 175164203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).