2-butyl-1H-imidazole;hexanoic acid

C13H24N2O2 — CID 175164203

IUPAC2-butyl-1H-imidazole;hexanoic acid
SMILESCCCCCC(=O)O.CCCCc1ncc[nH]1
InChIInChI=1S/C7H12N2.C6H12O2/c1-2-3-4-7-8-5-6-9-7;1-2-3-4-5-6(7)8/h5-6H,2-4H2,1H3,(H,8,9);2-5H2,1H3,(H,7,8)
InChIKeyHDWCULVQQOFCSQ-UHFFFAOYSA-N
MW240.35 g/mol
LogP3.40
Rot. Bonds7

About 2-butyl-1H-imidazole;hexanoic acid

2-butyl-1H-imidazole;hexanoic acid (PubChem CID 175164203) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 2-butyl-1H-imidazole;hexanoic acid.

Molecular Properties

Compound Name2-butyl-1H-imidazole;hexanoic acid
PubChem CID175164203
Molecular FormulaC13H24N2O2
Molecular Weight240.35 g/mol
Exact Mass240.18
IUPAC Name2-butyl-1H-imidazole;hexanoic acid
SMILESCCCCCC(=O)O.CCCCc1ncc[nH]1
InChIInChI=1S/C7H12N2.C6H12O2/c1-2-3-4-7-8-5-6-9-7;1-2-3-4-5-6(7)8/h5-6H,2-4H2,1H3,(H,8,9);2-5H2,1H3,(H,7,8)
InChIKeyHDWCULVQQOFCSQ-UHFFFAOYSA-N
XLogP3.40
TPSA65.98 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.35
LogP ≤ 53.40
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-butyl-1H-imidazole;hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-butyl-1H-imidazole;hexanoic acid?
The IUPAC name of 2-butyl-1H-imidazole;hexanoic acid (CID 175164203) is 2-butyl-1H-imidazole;hexanoic acid.
What is the SMILES notation for 2-butyl-1H-imidazole;hexanoic acid?
The canonical SMILES for 2-butyl-1H-imidazole;hexanoic acid is CCCCCC(=O)O.CCCCc1ncc[nH]1.
What is the InChIKey of 2-butyl-1H-imidazole;hexanoic acid?
The InChIKey is HDWCULVQQOFCSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2.C6H12O2/c1-2-3-4-7-8-5-6-9-7;1-2-3-4-5-6(7)8/h5-6H,2-4H2,1H3,(H,8,9);2-5H2,1H3,(H,7,8).
What are the key properties of 2-butyl-1H-imidazole;hexanoic acid?
2-butyl-1H-imidazole;hexanoic acid has a molecular weight of 240.35 g/mol, XLogP of 3.40, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-1H-imidazole;hexanoic acid is sourced from PubChem (CID 175164203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).