C28H54O7 — CID 175164288
1,2,3-trimethoxy-1-(1,2,3-trimethoxyundec-2-enoxy)undec-2-ene (PubChem CID 175164288) has the molecular formula C28H54O7 and a molecular weight of 502.73 g/mol. Its IUPAC name is 1,2,3-trimethoxy-1-(1,2,3-trimethoxyundec-2-enoxy)undec-2-ene.
| Compound Name | 1,2,3-trimethoxy-1-(1,2,3-trimethoxyundec-2-enoxy)undec-2-ene |
|---|---|
| PubChem CID | 175164288 |
| Molecular Formula | C28H54O7 |
| Molecular Weight | 502.73 g/mol |
| Exact Mass | 502.39 |
| IUPAC Name | 1,2,3-trimethoxy-1-(1,2,3-trimethoxyundec-2-enoxy)undec-2-ene |
| SMILES | CCCCCCCCC(OC)=C(OC)C(OC)OC(OC)C(OC)=C(CCCCCCCC)OC |
| InChI | InChI=1S/C28H54O7/c1-9-11-13-15-17-19-21-23(29-3)25(31-5)27(33-7)35-28(34-8)26(32-6)24(30-4)22-20-18-16-14-12-10-2/h27-28H,9-22H2,1-8H3 |
| InChIKey | BJTFABDKCCEGHX-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.73 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|