C15H16F5N3O3S — CID 175164352
2-(3-ethylsulfonyl-2-pyridinyl)-1-methyl-5-(2,2,3,3,3-pentafluoropropoxy)-2H-pyrimidine (PubChem CID 175164352) has the molecular formula C15H16F5N3O3S and a molecular weight of 413.37 g/mol. Its IUPAC name is 2-(3-ethylsulfonyl-2-pyridinyl)-1-methyl-5-(2,2,3,3,3-pentafluoropropoxy)-2H-pyrimidine.
| Compound Name | 2-(3-ethylsulfonyl-2-pyridinyl)-1-methyl-5-(2,2,3,3,3-pentafluoropropoxy)-2H-pyrimidine |
|---|---|
| PubChem CID | 175164352 |
| Molecular Formula | C15H16F5N3O3S |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | 2-(3-ethylsulfonyl-2-pyridinyl)-1-methyl-5-(2,2,3,3,3-pentafluoropropoxy)-2H-pyrimidine |
| SMILES | CCS(=O)(=O)c1cccnc1C1N=CC(OCC(F)(F)C(F)(F)F)=CN1C |
| InChI | InChI=1S/C15H16F5N3O3S/c1-3-27(24,25)11-5-4-6-21-12(11)13-22-7-10(8-23(13)2)26-9-14(16,17)15(18,19)20/h4-8,13H,3,9H2,1-2H3 |
| InChIKey | CIEDGBSYVRNOSD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 71.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|