C8H11N3O3S2 — CID 175164906
[(3R,6S)-6-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)oxan-3-yl] carbamate (PubChem CID 175164906) has the molecular formula C8H11N3O3S2 and a molecular weight of 261.33 g/mol. Its IUPAC name is [(3R,6S)-6-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)oxan-3-yl] carbamate.
| Compound Name | [(3R,6S)-6-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)oxan-3-yl] carbamate |
|---|---|
| PubChem CID | 175164906 |
| Molecular Formula | C8H11N3O3S2 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | [(3R,6S)-6-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)oxan-3-yl] carbamate |
| SMILES | NC(=O)O[C@@H]1CC[C@@H](c2n[nH]c(=S)s2)OC1 |
| InChI | InChI=1S/C8H11N3O3S2/c9-7(12)14-4-1-2-5(13-3-4)6-10-11-8(15)16-6/h4-5H,1-3H2,(H2,9,12)(H,11,15)/t4-,5+/m1/s1 |
| InChIKey | ZCPIWGSCCYHBHP-UHNVWZDZSA-N |
| XLogP | 1.52 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|