C19H18Br2N4O4S — CID 175165012
(4aR,6R,7R,8aR)-8-azido-8-(2,5-dibromo-3-pyridinyl)-7-methoxy-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-6-thiol (PubChem CID 175165012) has the molecular formula C19H18Br2N4O4S and a molecular weight of 558.25 g/mol. Its IUPAC name is (4aR,6R,7R,8aR)-8-azido-8-(2,5-dibromo-3-pyridinyl)-7-methoxy-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-6-thiol.
| Compound Name | (4aR,6R,7R,8aR)-8-azido-8-(2,5-dibromo-3-pyridinyl)-7-methoxy-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-6-thiol |
|---|---|
| PubChem CID | 175165012 |
| Molecular Formula | C19H18Br2N4O4S |
| Molecular Weight | 558.25 g/mol |
| Exact Mass | 555.94 |
| IUPAC Name | (4aR,6R,7R,8aR)-8-azido-8-(2,5-dibromo-3-pyridinyl)-7-methoxy-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-6-thiol |
| SMILES | CO[C@H]1[C@@H](S)O[C@@H]2COC(c3ccccc3)O[C@@H]2C1(N=[N+]=[N-])c1cc(Br)cnc1Br |
| InChI | InChI=1S/C19H18Br2N4O4S/c1-26-15-18(30)28-13-9-27-17(10-5-3-2-4-6-10)29-14(13)19(15,24-25-22)12-7-11(20)8-23-16(12)21/h2-8,13-15,17-18,30H,9H2,1H3/t13-,14+,15+,17?,18-,19?/m1/s1 |
| InChIKey | HWGIAALQFHTGCC-DROHFGBGSA-N |
| XLogP | 4.90 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.25 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|