About lithium;hexane;methyl(propan-2-yl)silane
lithium;hexane;methyl(propan-2-yl)silane (PubChem CID 175165127) has the molecular formula C10H25LiSi
and a molecular weight of 180.34 g/mol. Its IUPAC name is lithium;hexane;methyl(propan-2-yl)silane.
Molecular Properties
| Compound Name | lithium;hexane;methyl(propan-2-yl)silane |
| PubChem CID | 175165127 |
| Molecular Formula | C10H25LiSi |
| Molecular Weight | 180.34 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | lithium;hexane;methyl(propan-2-yl)silane |
| SMILES | CCCCCC.C[SiH2][C-](C)C.[Li+] |
| InChI | InChI=1S/C6H14.C4H11Si.Li/c1-3-5-6-4-2;1-4(2)5-3;/h3-6H2,1-2H3;5H2,1-3H3;/q;-1;+1 |
| InChIKey | LUVUHNPZOQDIQH-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.34 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze lithium;hexane;methyl(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hexane;methyl(propan-2-yl)silane?
The IUPAC name of lithium;hexane;methyl(propan-2-yl)silane (CID 175165127) is lithium;hexane;methyl(propan-2-yl)silane.
What is the SMILES notation for lithium;hexane;methyl(propan-2-yl)silane?
The canonical SMILES for lithium;hexane;methyl(propan-2-yl)silane is CCCCCC.C[SiH2][C-](C)C.[Li+].
What is the InChIKey of lithium;hexane;methyl(propan-2-yl)silane?
The InChIKey is LUVUHNPZOQDIQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14.C4H11Si.Li/c1-3-5-6-4-2;1-4(2)5-3;/h3-6H2,1-2H3;5H2,1-3H3;/q;-1;+1.
What are the key properties of lithium;hexane;methyl(propan-2-yl)silane?
lithium;hexane;methyl(propan-2-yl)silane has a molecular weight of 180.34 g/mol, XLogP of 0.37, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hexane;methyl(propan-2-yl)silane is sourced from PubChem (CID 175165127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).