About hexafluoroantimony(1-);thianthrene
hexafluoroantimony(1-);thianthrene (PubChem CID 175165503) has the molecular formula C12H8F6S2Sb-
and a molecular weight of 452.08 g/mol. Its IUPAC name is hexafluoroantimony(1-);thianthrene.
Molecular Properties
| Compound Name | hexafluoroantimony(1-);thianthrene |
| PubChem CID | 175165503 |
| Molecular Formula | C12H8F6S2Sb- |
| Molecular Weight | 452.08 g/mol |
| Exact Mass | 450.90 |
| IUPAC Name | hexafluoroantimony(1-);thianthrene |
| SMILES | F[Sb-](F)(F)(F)(F)F.c1ccc2c(c1)Sc1ccccc1S2 |
| InChI | InChI=1S/C12H8S2.6FH.Sb/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10;;;;;;;/h1-8H;6*1H;/q;;;;;;;+5/p-6 |
| InChIKey | ZTWQNTNLKMRBPF-UHFFFAOYSA-H |
| XLogP | 6.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.08 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze hexafluoroantimony(1-);thianthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexafluoroantimony(1-);thianthrene?
The IUPAC name of hexafluoroantimony(1-);thianthrene (CID 175165503) is hexafluoroantimony(1-);thianthrene.
What is the SMILES notation for hexafluoroantimony(1-);thianthrene?
The canonical SMILES for hexafluoroantimony(1-);thianthrene is F[Sb-](F)(F)(F)(F)F.c1ccc2c(c1)Sc1ccccc1S2.
What is the InChIKey of hexafluoroantimony(1-);thianthrene?
The InChIKey is ZTWQNTNLKMRBPF-UHFFFAOYSA-H. The full InChI is InChI=1S/C12H8S2.6FH.Sb/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10;;;;;;;/h1-8H;6*1H;/q;;;;;;;+5/p-6.
What are the key properties of hexafluoroantimony(1-);thianthrene?
hexafluoroantimony(1-);thianthrene has a molecular weight of 452.08 g/mol, XLogP of 6.44, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexafluoroantimony(1-);thianthrene is sourced from PubChem (CID 175165503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).