C13H11F18NO3S — CID 175165530
1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,10,10-octadecafluorodecane-1-sulfonic acid;prop-2-en-1-amine (PubChem CID 175165530) has the molecular formula C13H11F18NO3S and a molecular weight of 603.27 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,10,10-octadecafluorodecane-1-sulfonic acid;prop-2-en-1-amine.
| Compound Name | 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,10,10-octadecafluorodecane-1-sulfonic acid;prop-2-en-1-amine |
|---|---|
| PubChem CID | 175165530 |
| Molecular Formula | C13H11F18NO3S |
| Molecular Weight | 603.27 g/mol |
| Exact Mass | 603.02 |
| IUPAC Name | 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,10,10-octadecafluorodecane-1-sulfonic acid;prop-2-en-1-amine |
| SMILES | C=CCN.O=S(=O)(O)C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)F |
| InChI | InChI=1S/C10H4F18O3S.C3H7N/c11-1(2(12)13)4(15,16)6(19,20)8(23,24)10(27,28)9(25,26)7(21,22)5(17,18)3(14)32(29,30)31;1-2-3-4/h1-3H,(H,29,30,31);2H,1,3-4H2 |
| InChIKey | KTAKTWOVKMTLSJ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.27 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|