About sodium;hydride;morpholin-2-yl ethanesulfonate
sodium;hydride;morpholin-2-yl ethanesulfonate (PubChem CID 175166289) has the molecular formula C6H14NNaO4S
and a molecular weight of 219.24 g/mol. Its IUPAC name is sodium;hydride;morpholin-2-yl ethanesulfonate.
Molecular Properties
| Compound Name | sodium;hydride;morpholin-2-yl ethanesulfonate |
| PubChem CID | 175166289 |
| Molecular Formula | C6H14NNaO4S |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | sodium;hydride;morpholin-2-yl ethanesulfonate |
| SMILES | CCS(=O)(=O)OC1CNCCO1.[H-].[Na+] |
| InChI | InChI=1S/C6H13NO4S.Na.H/c1-2-12(8,9)11-6-5-7-3-4-10-6;;/h6-7H,2-5H2,1H3;;/q;+1;-1 |
| InChIKey | NXSXXNLKICAKJD-UHFFFAOYSA-N |
| XLogP | -3.58 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;morpholin-2-yl ethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;morpholin-2-yl ethanesulfonate?
The IUPAC name of sodium;hydride;morpholin-2-yl ethanesulfonate (CID 175166289) is sodium;hydride;morpholin-2-yl ethanesulfonate.
What is the SMILES notation for sodium;hydride;morpholin-2-yl ethanesulfonate?
The canonical SMILES for sodium;hydride;morpholin-2-yl ethanesulfonate is CCS(=O)(=O)OC1CNCCO1.[H-].[Na+].
What is the InChIKey of sodium;hydride;morpholin-2-yl ethanesulfonate?
The InChIKey is NXSXXNLKICAKJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO4S.Na.H/c1-2-12(8,9)11-6-5-7-3-4-10-6;;/h6-7H,2-5H2,1H3;;/q;+1;-1.
What are the key properties of sodium;hydride;morpholin-2-yl ethanesulfonate?
sodium;hydride;morpholin-2-yl ethanesulfonate has a molecular weight of 219.24 g/mol, XLogP of -3.58, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;morpholin-2-yl ethanesulfonate is sourced from PubChem (CID 175166289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).