C58H114O7 — CID 175166311
6-(4,5-dioctoxydodec-4-en-6-yloxymethoxymethoxy)-4,5-dioctoxydodec-4-ene (PubChem CID 175166311) has the molecular formula C58H114O7 and a molecular weight of 923.54 g/mol. Its IUPAC name is 6-(4,5-dioctoxydodec-4-en-6-yloxymethoxymethoxy)-4,5-dioctoxydodec-4-ene.
| Compound Name | 6-(4,5-dioctoxydodec-4-en-6-yloxymethoxymethoxy)-4,5-dioctoxydodec-4-ene |
|---|---|
| PubChem CID | 175166311 |
| Molecular Formula | C58H114O7 |
| Molecular Weight | 923.54 g/mol |
| Exact Mass | 922.86 |
| IUPAC Name | 6-(4,5-dioctoxydodec-4-en-6-yloxymethoxymethoxy)-4,5-dioctoxydodec-4-ene |
| SMILES | CCCCCCCCOC(CCC)=C(OCCCCCCCC)C(CCCCCC)OCOCOC(CCCCCC)C(OCCCCCCCC)=C(CCC)OCCCCCCCC |
| InChI | InChI=1S/C58H114O7/c1-9-17-23-29-33-39-47-60-53(43-15-7)57(62-49-41-35-31-25-19-11-3)55(45-37-27-21-13-5)64-51-59-52-65-56(46-38-28-22-14-6)58(63-50-42-36-32-26-20-12-4)54(44-16-8)61-48-40-34-30-24-18-10-2/h55-56H,9-52H2,1-8H3 |
| InChIKey | SVVOFLGCRKMGIK-UHFFFAOYSA-N |
| XLogP | 19.16 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.54 |
| LogP ≤ 5 | 19.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|