About 3,3-bis(1-fluoro-2-hydroxyethyl)pyrrolidine-1-carboxylic acid
3,3-bis(1-fluoro-2-hydroxyethyl)pyrrolidine-1-carboxylic acid (PubChem CID 175167022) has the molecular formula C9H15F2NO4
and a molecular weight of 239.22 g/mol. Its IUPAC name is 3,3-bis(1-fluoro-2-hydroxyethyl)pyrrolidine-1-carboxylic acid.
Analyze 3,3-bis(1-fluoro-2-hydroxyethyl)pyrrolidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-bis(1-fluoro-2-hydroxyethyl)pyrrolidine-1-carboxylic acid?
The IUPAC name of 3,3-bis(1-fluoro-2-hydroxyethyl)pyrrolidine-1-carboxylic acid (CID 175167022) is 3,3-bis(1-fluoro-2-hydroxyethyl)pyrrolidine-1-carboxylic acid.
What is the SMILES notation for 3,3-bis(1-fluoro-2-hydroxyethyl)pyrrolidine-1-carboxylic acid?
The canonical SMILES for 3,3-bis(1-fluoro-2-hydroxyethyl)pyrrolidine-1-carboxylic acid is O=C(O)N1CCC(C(F)CO)(C(F)CO)C1.
What is the InChIKey of 3,3-bis(1-fluoro-2-hydroxyethyl)pyrrolidine-1-carboxylic acid?
The InChIKey is GTXKBBSFWYYONN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F2NO4/c10-6(3-13)9(7(11)4-14)1-2-12(5-9)8(15)16/h6-7,13-14H,1-5H2,(H,15,16).
What are the key properties of 3,3-bis(1-fluoro-2-hydroxyethyl)pyrrolidine-1-carboxylic acid?
3,3-bis(1-fluoro-2-hydroxyethyl)pyrrolidine-1-carboxylic acid has a molecular weight of 239.22 g/mol, XLogP of 0.02, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-bis(1-fluoro-2-hydroxyethyl)pyrrolidine-1-carboxylic acid is sourced from PubChem (CID 175167022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).