C30H58O7 — CID 175167159
1,2,3-trimethoxy-1-(1,2,3-trimethoxydodec-2-enoxy)dodec-2-ene (PubChem CID 175167159) has the molecular formula C30H58O7 and a molecular weight of 530.79 g/mol. Its IUPAC name is 1,2,3-trimethoxy-1-(1,2,3-trimethoxydodec-2-enoxy)dodec-2-ene.
| Compound Name | 1,2,3-trimethoxy-1-(1,2,3-trimethoxydodec-2-enoxy)dodec-2-ene |
|---|---|
| PubChem CID | 175167159 |
| Molecular Formula | C30H58O7 |
| Molecular Weight | 530.79 g/mol |
| Exact Mass | 530.42 |
| IUPAC Name | 1,2,3-trimethoxy-1-(1,2,3-trimethoxydodec-2-enoxy)dodec-2-ene |
| SMILES | CCCCCCCCCC(OC)=C(OC)C(OC)OC(OC)C(OC)=C(CCCCCCCCC)OC |
| InChI | InChI=1S/C30H58O7/c1-9-11-13-15-17-19-21-23-25(31-3)27(33-5)29(35-7)37-30(36-8)28(34-6)26(32-4)24-22-20-18-16-14-12-10-2/h29-30H,9-24H2,1-8H3 |
| InChIKey | BHWVVDDBTKXDCF-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.79 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|