About 2-amino-3,5-dibromobenzaldehyde;chloroform
2-amino-3,5-dibromobenzaldehyde;chloroform (PubChem CID 175167427) has the molecular formula C8H6Br2Cl3NO
and a molecular weight of 398.31 g/mol. Its IUPAC name is 2-amino-3,5-dibromobenzaldehyde;chloroform.
Molecular Properties
| Compound Name | 2-amino-3,5-dibromobenzaldehyde;chloroform |
| PubChem CID | 175167427 |
| Molecular Formula | C8H6Br2Cl3NO |
| Molecular Weight | 398.31 g/mol |
| Exact Mass | 394.79 |
| IUPAC Name | 2-amino-3,5-dibromobenzaldehyde;chloroform |
| SMILES | ClC(Cl)Cl.Nc1c(Br)cc(Br)cc1C=O |
| InChI | InChI=1S/C7H5Br2NO.CHCl3/c8-5-1-4(3-11)7(10)6(9)2-5;2-1(3)4/h1-3H,10H2;1H |
| InChIKey | JMHORCJXUKLWDZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.31 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3,5-dibromobenzaldehyde;chloroform with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3,5-dibromobenzaldehyde;chloroform?
The IUPAC name of 2-amino-3,5-dibromobenzaldehyde;chloroform (CID 175167427) is 2-amino-3,5-dibromobenzaldehyde;chloroform.
What is the SMILES notation for 2-amino-3,5-dibromobenzaldehyde;chloroform?
The canonical SMILES for 2-amino-3,5-dibromobenzaldehyde;chloroform is ClC(Cl)Cl.Nc1c(Br)cc(Br)cc1C=O.
What is the InChIKey of 2-amino-3,5-dibromobenzaldehyde;chloroform?
The InChIKey is JMHORCJXUKLWDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5Br2NO.CHCl3/c8-5-1-4(3-11)7(10)6(9)2-5;2-1(3)4/h1-3H,10H2;1H.
What are the key properties of 2-amino-3,5-dibromobenzaldehyde;chloroform?
2-amino-3,5-dibromobenzaldehyde;chloroform has a molecular weight of 398.31 g/mol, XLogP of 4.59, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3,5-dibromobenzaldehyde;chloroform is sourced from PubChem (CID 175167427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).