C18H14ClFN4O5 — CID 175167482
[(2R,3R,4S,5R)-4-acetyloxy-5-(6-chloropurin-9-yl)-3-fluorooxolan-2-yl] benzoate (PubChem CID 175167482) has the molecular formula C18H14ClFN4O5 and a molecular weight of 420.78 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-4-acetyloxy-5-(6-chloropurin-9-yl)-3-fluorooxolan-2-yl] benzoate.
| Compound Name | [(2R,3R,4S,5R)-4-acetyloxy-5-(6-chloropurin-9-yl)-3-fluorooxolan-2-yl] benzoate |
|---|---|
| PubChem CID | 175167482 |
| Molecular Formula | C18H14ClFN4O5 |
| Molecular Weight | 420.78 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | [(2R,3R,4S,5R)-4-acetyloxy-5-(6-chloropurin-9-yl)-3-fluorooxolan-2-yl] benzoate |
| SMILES | CC(=O)O[C@@H]1[C@@H](F)[C@@H](OC(=O)c2ccccc2)O[C@H]1n1cnc2c(Cl)ncnc21 |
| InChI | InChI=1S/C18H14ClFN4O5/c1-9(25)27-13-11(20)18(29-17(26)10-5-3-2-4-6-10)28-16(13)24-8-23-12-14(19)21-7-22-15(12)24/h2-8,11,13,16,18H,1H3/t11-,13-,16-,18-/m1/s1 |
| InChIKey | BYYHZBYJMDCGOA-MAAOGQSESA-N |
| XLogP | 2.46 |
| TPSA | 105.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.78 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |