C6H17ClO3Si3 — CID 175167484
2-(3-chloropropyl)-2,4,6-trimethyl-1,3,5,2,4,6-trioxatrisilinane (PubChem CID 175167484) has the molecular formula C6H17ClO3Si3 and a molecular weight of 256.91 g/mol. Its IUPAC name is 2-(3-chloropropyl)-2,4,6-trimethyl-1,3,5,2,4,6-trioxatrisilinane.
| Compound Name | 2-(3-chloropropyl)-2,4,6-trimethyl-1,3,5,2,4,6-trioxatrisilinane |
|---|---|
| PubChem CID | 175167484 |
| Molecular Formula | C6H17ClO3Si3 |
| Molecular Weight | 256.91 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 2-(3-chloropropyl)-2,4,6-trimethyl-1,3,5,2,4,6-trioxatrisilinane |
| SMILES | C[SiH]1O[SiH](C)O[Si](C)(CCCCl)O1 |
| InChI | InChI=1S/C6H17ClO3Si3/c1-11-8-12(2)10-13(3,9-11)6-4-5-7/h11-12H,4-6H2,1-3H3 |
| InChIKey | WCPACDKSODQTGP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.91 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|