C8H11F3O3S2 — CID 175167610
3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]thiophen-5-yl trifluoromethanesulfonate (PubChem CID 175167610) has the molecular formula C8H11F3O3S2 and a molecular weight of 276.30 g/mol. Its IUPAC name is 3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]thiophen-5-yl trifluoromethanesulfonate.
| Compound Name | 3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]thiophen-5-yl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 175167610 |
| Molecular Formula | C8H11F3O3S2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]thiophen-5-yl trifluoromethanesulfonate |
| SMILES | O=S(=O)(OC1CC2CSCC2C1)C(F)(F)F |
| InChI | InChI=1S/C8H11F3O3S2/c9-8(10,11)16(12,13)14-7-1-5-3-15-4-6(5)2-7/h5-7H,1-4H2 |
| InChIKey | RGVBVLJMHRFCCS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|