About chromen-4-one;oxadiazole
chromen-4-one;oxadiazole (PubChem CID 175168262) has the molecular formula C11H8N2O3
and a molecular weight of 216.20 g/mol. Its IUPAC name is chromen-4-one;oxadiazole.
Molecular Properties
| Compound Name | chromen-4-one;oxadiazole |
| PubChem CID | 175168262 |
| Molecular Formula | C11H8N2O3 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | chromen-4-one;oxadiazole |
| SMILES | O=c1ccoc2ccccc12.c1conn1 |
| InChI | InChI=1S/C9H6O2.C2H2N2O/c10-8-5-6-11-9-4-2-1-3-7(8)9;1-2-5-4-3-1/h1-6H;1-2H |
| InChIKey | GLSUZTUHOUHFGF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 69.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze chromen-4-one;oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromen-4-one;oxadiazole?
The IUPAC name of chromen-4-one;oxadiazole (CID 175168262) is chromen-4-one;oxadiazole.
What is the SMILES notation for chromen-4-one;oxadiazole?
The canonical SMILES for chromen-4-one;oxadiazole is O=c1ccoc2ccccc12.c1conn1.
What is the InChIKey of chromen-4-one;oxadiazole?
The InChIKey is GLSUZTUHOUHFGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O2.C2H2N2O/c10-8-5-6-11-9-4-2-1-3-7(8)9;1-2-5-4-3-1/h1-6H;1-2H.
What are the key properties of chromen-4-one;oxadiazole?
chromen-4-one;oxadiazole has a molecular weight of 216.20 g/mol, XLogP of 1.86, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for chromen-4-one;oxadiazole is sourced from PubChem (CID 175168262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).