C12H14 — CID 175168315
5,8-dimethylidene-1,4,4a,8a-tetrahydronaphthalene (PubChem CID 175168315) has the molecular formula C12H14 and a molecular weight of 158.24 g/mol. Its IUPAC name is 5,8-dimethylidene-1,4,4a,8a-tetrahydronaphthalene.
| Compound Name | 5,8-dimethylidene-1,4,4a,8a-tetrahydronaphthalene |
|---|---|
| PubChem CID | 175168315 |
| Molecular Formula | C12H14 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 5,8-dimethylidene-1,4,4a,8a-tetrahydronaphthalene |
| SMILES | C=C1C=CC(=C)C2CC=CCC12 |
| InChI | InChI=1S/C12H14/c1-9-7-8-10(2)12-6-4-3-5-11(9)12/h3-4,7-8,11-12H,1-2,5-6H2 |
| InChIKey | CCPAOMMFRIZKAL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|