About 2-amino-6-(3,5-dimethoxyphenyl)-8-methyl-3H-pteridine-4,7-dione
2-amino-6-(3,5-dimethoxyphenyl)-8-methyl-3H-pteridine-4,7-dione (PubChem CID 175169311) has the molecular formula C15H15N5O4
and a molecular weight of 329.32 g/mol. Its IUPAC name is 2-amino-6-(3,5-dimethoxyphenyl)-8-methyl-3H-pteridine-4,7-dione.
Molecular Properties
| Compound Name | 2-amino-6-(3,5-dimethoxyphenyl)-8-methyl-3H-pteridine-4,7-dione |
| PubChem CID | 175169311 |
| Molecular Formula | C15H15N5O4 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 2-amino-6-(3,5-dimethoxyphenyl)-8-methyl-3H-pteridine-4,7-dione |
| SMILES | COc1cc(OC)cc(-c2nc3c(=O)[nH]c(N)nc3n(C)c2=O)c1 |
| InChI | InChI=1S/C15H15N5O4/c1-20-12-11(13(21)19-15(16)18-12)17-10(14(20)22)7-4-8(23-2)6-9(5-7)24-3/h4-6H,1-3H3,(H3,16,18,19,21) |
| InChIKey | OQJRTKXRZGAGJP-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-amino-6-(3,5-dimethoxyphenyl)-8-methyl-3H-pteridine-4,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-(3,5-dimethoxyphenyl)-8-methyl-3H-pteridine-4,7-dione?
The IUPAC name of 2-amino-6-(3,5-dimethoxyphenyl)-8-methyl-3H-pteridine-4,7-dione (CID 175169311) is 2-amino-6-(3,5-dimethoxyphenyl)-8-methyl-3H-pteridine-4,7-dione.
What is the SMILES notation for 2-amino-6-(3,5-dimethoxyphenyl)-8-methyl-3H-pteridine-4,7-dione?
The canonical SMILES for 2-amino-6-(3,5-dimethoxyphenyl)-8-methyl-3H-pteridine-4,7-dione is COc1cc(OC)cc(-c2nc3c(=O)[nH]c(N)nc3n(C)c2=O)c1.
What is the InChIKey of 2-amino-6-(3,5-dimethoxyphenyl)-8-methyl-3H-pteridine-4,7-dione?
The InChIKey is OQJRTKXRZGAGJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N5O4/c1-20-12-11(13(21)19-15(16)18-12)17-10(14(20)22)7-4-8(23-2)6-9(5-7)24-3/h4-6H,1-3H3,(H3,16,18,19,21).
What are the key properties of 2-amino-6-(3,5-dimethoxyphenyl)-8-methyl-3H-pteridine-4,7-dione?
2-amino-6-(3,5-dimethoxyphenyl)-8-methyl-3H-pteridine-4,7-dione has a molecular weight of 329.32 g/mol, XLogP of 0.28, 3 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-(3,5-dimethoxyphenyl)-8-methyl-3H-pteridine-4,7-dione is sourced from PubChem (CID 175169311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).