About azane;6-methylheptyl hydrogen sulfate;hydrate
azane;6-methylheptyl hydrogen sulfate;hydrate (PubChem CID 175169706) has the molecular formula C8H23NO5S
and a molecular weight of 245.34 g/mol. Its IUPAC name is azane;6-methylheptyl hydrogen sulfate;hydrate.
Molecular Properties
| Compound Name | azane;6-methylheptyl hydrogen sulfate;hydrate |
| PubChem CID | 175169706 |
| Molecular Formula | C8H23NO5S |
| Molecular Weight | 245.34 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | azane;6-methylheptyl hydrogen sulfate;hydrate |
| SMILES | CC(C)CCCCCOS(=O)(=O)O.N.O |
| InChI | InChI=1S/C8H18O4S.H3N.H2O/c1-8(2)6-4-3-5-7-12-13(9,10)11;;/h8H,3-7H2,1-2H3,(H,9,10,11);1H3;1H2 |
| InChIKey | QBLJKJQIXXSWQZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 130.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze azane;6-methylheptyl hydrogen sulfate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;6-methylheptyl hydrogen sulfate;hydrate?
The IUPAC name of azane;6-methylheptyl hydrogen sulfate;hydrate (CID 175169706) is azane;6-methylheptyl hydrogen sulfate;hydrate.
What is the SMILES notation for azane;6-methylheptyl hydrogen sulfate;hydrate?
The canonical SMILES for azane;6-methylheptyl hydrogen sulfate;hydrate is CC(C)CCCCCOS(=O)(=O)O.N.O.
What is the InChIKey of azane;6-methylheptyl hydrogen sulfate;hydrate?
The InChIKey is QBLJKJQIXXSWQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O4S.H3N.H2O/c1-8(2)6-4-3-5-7-12-13(9,10)11;;/h8H,3-7H2,1-2H3,(H,9,10,11);1H3;1H2.
What are the key properties of azane;6-methylheptyl hydrogen sulfate;hydrate?
azane;6-methylheptyl hydrogen sulfate;hydrate has a molecular weight of 245.34 g/mol, XLogP of 1.36, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;6-methylheptyl hydrogen sulfate;hydrate is sourced from PubChem (CID 175169706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).