C61H60O4 — CID 175169933
2-[(5-tert-butyl-2,3,4-triphenylphenoxy)-(5-tert-butyl-2,3,4-triphenylphenyl)methyl]-2-(hydroxymethyl)propane-1,3-diol (PubChem CID 175169933) has the molecular formula C61H60O4 and a molecular weight of 857.15 g/mol. Its IUPAC name is 2-[(5-tert-butyl-2,3,4-triphenylphenoxy)-(5-tert-butyl-2,3,4-triphenylphenyl)methyl]-2-(hydroxymethyl)propane-1,3-diol.
| Compound Name | 2-[(5-tert-butyl-2,3,4-triphenylphenoxy)-(5-tert-butyl-2,3,4-triphenylphenyl)methyl]-2-(hydroxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 175169933 |
| Molecular Formula | C61H60O4 |
| Molecular Weight | 857.15 g/mol |
| Exact Mass | 856.45 |
| IUPAC Name | 2-[(5-tert-butyl-2,3,4-triphenylphenoxy)-(5-tert-butyl-2,3,4-triphenylphenyl)methyl]-2-(hydroxymethyl)propane-1,3-diol |
| SMILES | CC(C)(C)c1cc(OC(c2cc(C(C)(C)C)c(-c3ccccc3)c(-c3ccccc3)c2-c2ccccc2)C(CO)(CO)CO)c(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C61H60O4/c1-59(2,3)49-37-48(52(42-25-13-7-14-26-42)56(46-33-21-11-22-34-46)53(49)43-27-15-8-16-28-43)58(61(39-62,40-63)41-64)65-51-38-50(60(4,5)6)54(44-29-17-9-18-30-44)57(47-35-23-12-24-36-47)55(51)45-31-19-10-20-32-45/h7-38,58,62-64H,39-41H2,1-6H3 |
| InChIKey | QVSMOIJBSPHIES-UHFFFAOYSA-N |
| XLogP | 14.37 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.15 |
| LogP ≤ 5 | 14.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |