C24H46O7 — CID 175170274
1,2,3-trimethoxy-1-(1,2,3-trimethoxynon-2-enoxy)non-2-ene (PubChem CID 175170274) has the molecular formula C24H46O7 and a molecular weight of 446.63 g/mol. Its IUPAC name is 1,2,3-trimethoxy-1-(1,2,3-trimethoxynon-2-enoxy)non-2-ene.
| Compound Name | 1,2,3-trimethoxy-1-(1,2,3-trimethoxynon-2-enoxy)non-2-ene |
|---|---|
| PubChem CID | 175170274 |
| Molecular Formula | C24H46O7 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.32 |
| IUPAC Name | 1,2,3-trimethoxy-1-(1,2,3-trimethoxynon-2-enoxy)non-2-ene |
| SMILES | CCCCCCC(OC)=C(OC)C(OC)OC(OC)C(OC)=C(CCCCCC)OC |
| InChI | InChI=1S/C24H46O7/c1-9-11-13-15-17-19(25-3)21(27-5)23(29-7)31-24(30-8)22(28-6)20(26-4)18-16-14-12-10-2/h23-24H,9-18H2,1-8H3 |
| InChIKey | MSGXZCNEESNHTL-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|