C12H13F3N6O2 — CID 175170378
4-(2-aminoethylamino)-N-hydroxy-N'-[4-(trifluoromethyl)phenyl]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 175170378) has the molecular formula C12H13F3N6O2 and a molecular weight of 330.27 g/mol. Its IUPAC name is 4-(2-aminoethylamino)-N-hydroxy-N'-[4-(trifluoromethyl)phenyl]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-(2-aminoethylamino)-N-hydroxy-N'-[4-(trifluoromethyl)phenyl]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 175170378 |
| Molecular Formula | C12H13F3N6O2 |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 4-(2-aminoethylamino)-N-hydroxy-N'-[4-(trifluoromethyl)phenyl]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | NCCNc1nonc1/C(=N/c1ccc(C(F)(F)F)cc1)NO |
| InChI | InChI=1S/C12H13F3N6O2/c13-12(14,15)7-1-3-8(4-2-7)18-11(19-22)9-10(17-6-5-16)21-23-20-9/h1-4,22H,5-6,16H2,(H,17,21)(H,18,19) |
| InChIKey | RZAXYNCJXJTYNO-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 121.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|