About 1,5-bis(propan-2-ylamino)cyclohexa-2,4-dien-1-ol
1,5-bis(propan-2-ylamino)cyclohexa-2,4-dien-1-ol (PubChem CID 175170606) has the molecular formula C12H22N2O
and a molecular weight of 210.32 g/mol. Its IUPAC name is 1,5-bis(propan-2-ylamino)cyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | 1,5-bis(propan-2-ylamino)cyclohexa-2,4-dien-1-ol |
| PubChem CID | 175170606 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 1,5-bis(propan-2-ylamino)cyclohexa-2,4-dien-1-ol |
| SMILES | CC(C)NC1=CC=CC(O)(NC(C)C)C1 |
| InChI | InChI=1S/C12H22N2O/c1-9(2)13-11-6-5-7-12(15,8-11)14-10(3)4/h5-7,9-10,13-15H,8H2,1-4H3 |
| InChIKey | JADURQAQVQWHJP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,5-bis(propan-2-ylamino)cyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-bis(propan-2-ylamino)cyclohexa-2,4-dien-1-ol?
The IUPAC name of 1,5-bis(propan-2-ylamino)cyclohexa-2,4-dien-1-ol (CID 175170606) is 1,5-bis(propan-2-ylamino)cyclohexa-2,4-dien-1-ol.
What is the SMILES notation for 1,5-bis(propan-2-ylamino)cyclohexa-2,4-dien-1-ol?
The canonical SMILES for 1,5-bis(propan-2-ylamino)cyclohexa-2,4-dien-1-ol is CC(C)NC1=CC=CC(O)(NC(C)C)C1.
What is the InChIKey of 1,5-bis(propan-2-ylamino)cyclohexa-2,4-dien-1-ol?
The InChIKey is JADURQAQVQWHJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O/c1-9(2)13-11-6-5-7-12(15,8-11)14-10(3)4/h5-7,9-10,13-15H,8H2,1-4H3.
What are the key properties of 1,5-bis(propan-2-ylamino)cyclohexa-2,4-dien-1-ol?
1,5-bis(propan-2-ylamino)cyclohexa-2,4-dien-1-ol has a molecular weight of 210.32 g/mol, XLogP of 1.51, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-bis(propan-2-ylamino)cyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 175170606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).