About 9-amino-7-methyl-3,8-dihydropurine-6-thione
9-amino-7-methyl-3,8-dihydropurine-6-thione (PubChem CID 175171169) has the molecular formula C6H9N5S
and a molecular weight of 183.24 g/mol. Its IUPAC name is 9-amino-7-methyl-3,8-dihydropurine-6-thione.
Molecular Properties
| Compound Name | 9-amino-7-methyl-3,8-dihydropurine-6-thione |
| PubChem CID | 175171169 |
| Molecular Formula | C6H9N5S |
| Molecular Weight | 183.24 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 9-amino-7-methyl-3,8-dihydropurine-6-thione |
| SMILES | CN1CN(N)c2[nH]cnc(=S)c21 |
| InChI | InChI=1S/C6H9N5S/c1-10-3-11(7)5-4(10)6(12)9-2-8-5/h2H,3,7H2,1H3,(H,8,9,12) |
| InChIKey | VJLQHGSVOGEOHM-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 61.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.24 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 9-amino-7-methyl-3,8-dihydropurine-6-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-amino-7-methyl-3,8-dihydropurine-6-thione?
The IUPAC name of 9-amino-7-methyl-3,8-dihydropurine-6-thione (CID 175171169) is 9-amino-7-methyl-3,8-dihydropurine-6-thione.
What is the SMILES notation for 9-amino-7-methyl-3,8-dihydropurine-6-thione?
The canonical SMILES for 9-amino-7-methyl-3,8-dihydropurine-6-thione is CN1CN(N)c2[nH]cnc(=S)c21.
What is the InChIKey of 9-amino-7-methyl-3,8-dihydropurine-6-thione?
The InChIKey is VJLQHGSVOGEOHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N5S/c1-10-3-11(7)5-4(10)6(12)9-2-8-5/h2H,3,7H2,1H3,(H,8,9,12).
What are the key properties of 9-amino-7-methyl-3,8-dihydropurine-6-thione?
9-amino-7-methyl-3,8-dihydropurine-6-thione has a molecular weight of 183.24 g/mol, XLogP of 0.23, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-amino-7-methyl-3,8-dihydropurine-6-thione is sourced from PubChem (CID 175171169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).