C20H31N3O — CID 175171225
3-[1-amino-2-(3,7-dimethylocta-2,6-dienylamino)ethyl]-1,2-dihydroindol-3-ol (PubChem CID 175171225) has the molecular formula C20H31N3O and a molecular weight of 329.49 g/mol. Its IUPAC name is 3-[1-amino-2-(3,7-dimethylocta-2,6-dienylamino)ethyl]-1,2-dihydroindol-3-ol.
| Compound Name | 3-[1-amino-2-(3,7-dimethylocta-2,6-dienylamino)ethyl]-1,2-dihydroindol-3-ol |
|---|---|
| PubChem CID | 175171225 |
| Molecular Formula | C20H31N3O |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.25 |
| IUPAC Name | 3-[1-amino-2-(3,7-dimethylocta-2,6-dienylamino)ethyl]-1,2-dihydroindol-3-ol |
| SMILES | CC(C)=CCCC(C)=CCNCC(N)C1(O)CNc2ccccc21 |
| InChI | InChI=1S/C20H31N3O/c1-15(2)7-6-8-16(3)11-12-22-13-19(21)20(24)14-23-18-10-5-4-9-17(18)20/h4-5,7,9-11,19,22-24H,6,8,12-14,21H2,1-3H3 |
| InChIKey | CBMXOKWNIYKTJQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|