C14H29NO8S2 — CID 175171426
[(4R)-2,6,6-trimethyl-7-methylsulfonyloxy-4-(methylsulfonyloxymethyl)heptan-2-yl]carbamic acid (PubChem CID 175171426) has the molecular formula C14H29NO8S2 and a molecular weight of 403.52 g/mol. Its IUPAC name is [(4R)-2,6,6-trimethyl-7-methylsulfonyloxy-4-(methylsulfonyloxymethyl)heptan-2-yl]carbamic acid.
| Compound Name | [(4R)-2,6,6-trimethyl-7-methylsulfonyloxy-4-(methylsulfonyloxymethyl)heptan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 175171426 |
| Molecular Formula | C14H29NO8S2 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | [(4R)-2,6,6-trimethyl-7-methylsulfonyloxy-4-(methylsulfonyloxymethyl)heptan-2-yl]carbamic acid |
| SMILES | CC(C)(COS(C)(=O)=O)C[C@@H](COS(C)(=O)=O)CC(C)(C)NC(=O)O |
| InChI | InChI=1S/C14H29NO8S2/c1-13(2,10-23-25(6,20)21)7-11(9-22-24(5,18)19)8-14(3,4)15-12(16)17/h11,15H,7-10H2,1-6H3,(H,16,17)/t11-/m1/s1 |
| InChIKey | FMVAJYSSYMRALL-LLVKDONJSA-N |
| XLogP | 1.41 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|