C15H26N4O3S — CID 175171673
(2S)-N-(7-formamido-8,8-dimethyl-5-oxo-2,3,4,7,9,9a-hexahydropyrrolo[2,1-b][1,3]thiazepin-4-yl)-2-(methylamino)propanamide (PubChem CID 175171673) has the molecular formula C15H26N4O3S and a molecular weight of 342.47 g/mol. Its IUPAC name is (2S)-N-(7-formamido-8,8-dimethyl-5-oxo-2,3,4,7,9,9a-hexahydropyrrolo[2,1-b][1,3]thiazepin-4-yl)-2-(methylamino)propanamide.
| Compound Name | (2S)-N-(7-formamido-8,8-dimethyl-5-oxo-2,3,4,7,9,9a-hexahydropyrrolo[2,1-b][1,3]thiazepin-4-yl)-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 175171673 |
| Molecular Formula | C15H26N4O3S |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | (2S)-N-(7-formamido-8,8-dimethyl-5-oxo-2,3,4,7,9,9a-hexahydropyrrolo[2,1-b][1,3]thiazepin-4-yl)-2-(methylamino)propanamide |
| SMILES | CN[C@@H](C)C(=O)NC1CCSC2CC(C)(C)C(NC=O)N2C1=O |
| InChI | InChI=1S/C15H26N4O3S/c1-9(16-4)12(21)18-10-5-6-23-11-7-15(2,3)14(17-8-20)19(11)13(10)22/h8-11,14,16H,5-7H2,1-4H3,(H,17,20)(H,18,21)/t9-,10?,11?,14?/m0/s1 |
| InChIKey | BDDYFXZNWVFUEI-ICYBPSJXSA-N |
| XLogP | -0.13 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|