About sodium;3-(4,5-dihydroimidazol-1-yloxycarbonyl)hexanoic acid;hydride
sodium;3-(4,5-dihydroimidazol-1-yloxycarbonyl)hexanoic acid;hydride (PubChem CID 175172639) has the molecular formula C10H17N2NaO4
and a molecular weight of 252.25 g/mol. Its IUPAC name is sodium;3-(4,5-dihydroimidazol-1-yloxycarbonyl)hexanoic acid;hydride.
Molecular Properties
| Compound Name | sodium;3-(4,5-dihydroimidazol-1-yloxycarbonyl)hexanoic acid;hydride |
| PubChem CID | 175172639 |
| Molecular Formula | C10H17N2NaO4 |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | sodium;3-(4,5-dihydroimidazol-1-yloxycarbonyl)hexanoic acid;hydride |
| SMILES | CCCC(CC(=O)O)C(=O)ON1C=NCC1.[H-].[Na+] |
| InChI | InChI=1S/C10H16N2O4.Na.H/c1-2-3-8(6-9(13)14)10(15)16-12-5-4-11-7-12;;/h7-8H,2-6H2,1H3,(H,13,14);;/q;+1;-1 |
| InChIKey | AAGFCOLNSBWLRT-UHFFFAOYSA-N |
| XLogP | -2.20 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze sodium;3-(4,5-dihydroimidazol-1-yloxycarbonyl)hexanoic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;3-(4,5-dihydroimidazol-1-yloxycarbonyl)hexanoic acid;hydride?
The IUPAC name of sodium;3-(4,5-dihydroimidazol-1-yloxycarbonyl)hexanoic acid;hydride (CID 175172639) is sodium;3-(4,5-dihydroimidazol-1-yloxycarbonyl)hexanoic acid;hydride.
What is the SMILES notation for sodium;3-(4,5-dihydroimidazol-1-yloxycarbonyl)hexanoic acid;hydride?
The canonical SMILES for sodium;3-(4,5-dihydroimidazol-1-yloxycarbonyl)hexanoic acid;hydride is CCCC(CC(=O)O)C(=O)ON1C=NCC1.[H-].[Na+].
What is the InChIKey of sodium;3-(4,5-dihydroimidazol-1-yloxycarbonyl)hexanoic acid;hydride?
The InChIKey is AAGFCOLNSBWLRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O4.Na.H/c1-2-3-8(6-9(13)14)10(15)16-12-5-4-11-7-12;;/h7-8H,2-6H2,1H3,(H,13,14);;/q;+1;-1.
What are the key properties of sodium;3-(4,5-dihydroimidazol-1-yloxycarbonyl)hexanoic acid;hydride?
sodium;3-(4,5-dihydroimidazol-1-yloxycarbonyl)hexanoic acid;hydride has a molecular weight of 252.25 g/mol, XLogP of -2.20, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;3-(4,5-dihydroimidazol-1-yloxycarbonyl)hexanoic acid;hydride is sourced from PubChem (CID 175172639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).