About 4-(thiiran-2-yl)-3,8-dithiatricyclo[5.1.0.02,4]oct-5-ene
4-(thiiran-2-yl)-3,8-dithiatricyclo[5.1.0.02,4]oct-5-ene (PubChem CID 175172733) has the molecular formula C8H8S3
and a molecular weight of 200.35 g/mol. Its IUPAC name is 4-(thiiran-2-yl)-3,8-dithiatricyclo[5.1.0.02,4]oct-5-ene.
Molecular Properties
| Compound Name | 4-(thiiran-2-yl)-3,8-dithiatricyclo[5.1.0.02,4]oct-5-ene |
| PubChem CID | 175172733 |
| Molecular Formula | C8H8S3 |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 199.98 |
| IUPAC Name | 4-(thiiran-2-yl)-3,8-dithiatricyclo[5.1.0.02,4]oct-5-ene |
| SMILES | C1=CC2(C3CS3)SC2C2SC12 |
| InChI | InChI=1S/C8H8S3/c1-2-8(5-3-9-5)7(11-8)6-4(1)10-6/h1-2,4-7H,3H2 |
| InChIKey | OLWXBXOXDTVLCU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-(thiiran-2-yl)-3,8-dithiatricyclo[5.1.0.02,4]oct-5-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(thiiran-2-yl)-3,8-dithiatricyclo[5.1.0.02,4]oct-5-ene?
The IUPAC name of 4-(thiiran-2-yl)-3,8-dithiatricyclo[5.1.0.02,4]oct-5-ene (CID 175172733) is 4-(thiiran-2-yl)-3,8-dithiatricyclo[5.1.0.02,4]oct-5-ene.
What is the SMILES notation for 4-(thiiran-2-yl)-3,8-dithiatricyclo[5.1.0.02,4]oct-5-ene?
The canonical SMILES for 4-(thiiran-2-yl)-3,8-dithiatricyclo[5.1.0.02,4]oct-5-ene is C1=CC2(C3CS3)SC2C2SC12.
What is the InChIKey of 4-(thiiran-2-yl)-3,8-dithiatricyclo[5.1.0.02,4]oct-5-ene?
The InChIKey is OLWXBXOXDTVLCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8S3/c1-2-8(5-3-9-5)7(11-8)6-4(1)10-6/h1-2,4-7H,3H2.
What are the key properties of 4-(thiiran-2-yl)-3,8-dithiatricyclo[5.1.0.02,4]oct-5-ene?
4-(thiiran-2-yl)-3,8-dithiatricyclo[5.1.0.02,4]oct-5-ene has a molecular weight of 200.35 g/mol, XLogP of 2.01, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(thiiran-2-yl)-3,8-dithiatricyclo[5.1.0.02,4]oct-5-ene is sourced from PubChem (CID 175172733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).