About N,N-diethylethanamine;methanediimine;hydrochloride
N,N-diethylethanamine;methanediimine;hydrochloride (PubChem CID 175172874) has the molecular formula C7H18ClN3
and a molecular weight of 179.69 g/mol. Its IUPAC name is N,N-diethylethanamine;methanediimine;hydrochloride.
Molecular Properties
| Compound Name | N,N-diethylethanamine;methanediimine;hydrochloride |
| PubChem CID | 175172874 |
| Molecular Formula | C7H18ClN3 |
| Molecular Weight | 179.69 g/mol |
| Exact Mass | 179.12 |
| IUPAC Name | N,N-diethylethanamine;methanediimine;hydrochloride |
| SMILES | CCN(CC)CC.Cl.N=C=N |
| InChI | InChI=1S/C6H15N.CH2N2.ClH/c1-4-7(5-2)6-3;2-1-3;/h4-6H2,1-3H3;2-3H;1H |
| InChIKey | UUJFKDIBCVJMTM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.69 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethylethanamine;methanediimine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;methanediimine;hydrochloride?
The IUPAC name of N,N-diethylethanamine;methanediimine;hydrochloride (CID 175172874) is N,N-diethylethanamine;methanediimine;hydrochloride.
What is the SMILES notation for N,N-diethylethanamine;methanediimine;hydrochloride?
The canonical SMILES for N,N-diethylethanamine;methanediimine;hydrochloride is CCN(CC)CC.Cl.N=C=N.
What is the InChIKey of N,N-diethylethanamine;methanediimine;hydrochloride?
The InChIKey is UUJFKDIBCVJMTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.CH2N2.ClH/c1-4-7(5-2)6-3;2-1-3;/h4-6H2,1-3H3;2-3H;1H.
What are the key properties of N,N-diethylethanamine;methanediimine;hydrochloride?
N,N-diethylethanamine;methanediimine;hydrochloride has a molecular weight of 179.69 g/mol, XLogP of 2.09, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;methanediimine;hydrochloride is sourced from PubChem (CID 175172874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).